C15H20ClNO3 — CID 22833283
(1R,4R,5S)-4-(2-chloroethyl)-1-[[(1R)-cyclohex-2-en-1-yl]methyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 22833283) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is (1R,4R,5S)-4-(2-chloroethyl)-1-[[(1R)-cyclohex-2-en-1-yl]methyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (1R,4R,5S)-4-(2-chloroethyl)-1-[[(1R)-cyclohex-2-en-1-yl]methyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 22833283 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (1R,4R,5S)-4-(2-chloroethyl)-1-[[(1R)-cyclohex-2-en-1-yl]methyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | C[C@@]12OC(=O)[C@]1(C[C@@H]1C=CCCC1)NC(=O)[C@@H]2CCCl |
| InChI | InChI=1S/C15H20ClNO3/c1-14-11(7-8-16)12(18)17-15(14,13(19)20-14)9-10-5-3-2-4-6-10/h3,5,10-11H,2,4,6-9H2,1H3,(H,17,18)/t10-,11+,14+,15+/m1/s1 |
| InChIKey | URJGVVMJOFUXRZ-PKIAMQTDSA-N |
| XLogP | 2.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|