About azanium 2,3-dimethylbenzenesulfonate
azanium 2,3-dimethylbenzenesulfonate (PubChem CID 22833320) has the molecular formula C8H13NO3S
and a molecular weight of 203.26 g/mol. Its IUPAC name is azanium 2,3-dimethylbenzenesulfonate.
Molecular Properties
| Compound Name | azanium 2,3-dimethylbenzenesulfonate |
| PubChem CID | 22833320 |
| Molecular Formula | C8H13NO3S |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | azanium 2,3-dimethylbenzenesulfonate |
| SMILES | Cc1cccc(S(=O)(=O)[O-])c1C.[NH4+] |
| InChI | InChI=1S/C8H10O3S.H3N/c1-6-4-3-5-8(7(6)2)12(9,10)11;/h3-5H,1-2H3,(H,9,10,11);1H3 |
| InChIKey | MPYVAOBZGSNBFX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azanium 2,3-dimethylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 2,3-dimethylbenzenesulfonate?
The IUPAC name of azanium 2,3-dimethylbenzenesulfonate (CID 22833320) is azanium 2,3-dimethylbenzenesulfonate.
What is the SMILES notation for azanium 2,3-dimethylbenzenesulfonate?
The canonical SMILES for azanium 2,3-dimethylbenzenesulfonate is Cc1cccc(S(=O)(=O)[O-])c1C.[NH4+].
What is the InChIKey of azanium 2,3-dimethylbenzenesulfonate?
The InChIKey is MPYVAOBZGSNBFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3S.H3N/c1-6-4-3-5-8(7(6)2)12(9,10)11;/h3-5H,1-2H3,(H,9,10,11);1H3.
What are the key properties of azanium 2,3-dimethylbenzenesulfonate?
azanium 2,3-dimethylbenzenesulfonate has a molecular weight of 203.26 g/mol, XLogP of 1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 2,3-dimethylbenzenesulfonate is sourced from PubChem (CID 22833320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).