C20H34Cl8 — CID 22833341
2,4,5,8,11,12,14,17-octachloroicosane (PubChem CID 22833341) has the molecular formula C20H34Cl8 and a molecular weight of 558.12 g/mol. Its IUPAC name is 2,4,5,8,11,12,14,17-octachloroicosane.
| Compound Name | 2,4,5,8,11,12,14,17-octachloroicosane |
|---|---|
| PubChem CID | 22833341 |
| Molecular Formula | C20H34Cl8 |
| Molecular Weight | 558.12 g/mol |
| Exact Mass | 554.02 |
| IUPAC Name | 2,4,5,8,11,12,14,17-octachloroicosane |
| SMILES | CCCC(Cl)CCC(Cl)CC(Cl)C(Cl)CCC(Cl)CCC(Cl)C(Cl)CC(C)Cl |
| InChI | InChI=1S/C20H34Cl8/c1-3-4-14(22)5-6-16(24)12-20(28)18(26)10-8-15(23)7-9-17(25)19(27)11-13(2)21/h13-20H,3-12H2,1-2H3 |
| InChIKey | GHPXWFDSOBCWEE-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.12 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|