C29H19N5Na2O7S — CID 22833485
disodium;(3Z)-3-[[4-[4-[(2Z)-2-(7-amino-1-oxo-3-sulfonatonaphthalen-2-ylidene)hydrazinyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylate (PubChem CID 22833485) has the molecular formula C29H19N5Na2O7S and a molecular weight of 627.55 g/mol. Its IUPAC name is disodium;(3Z)-3-[[4-[4-[(2Z)-2-(7-amino-1-oxo-3-sulfonatonaphthalen-2-ylidene)hydrazinyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylate.
| Compound Name | disodium;(3Z)-3-[[4-[4-[(2Z)-2-(7-amino-1-oxo-3-sulfonatonaphthalen-2-ylidene)hydrazinyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 22833485 |
| Molecular Formula | C29H19N5Na2O7S |
| Molecular Weight | 627.55 g/mol |
| Exact Mass | 627.08 |
| IUPAC Name | disodium;(3Z)-3-[[4-[4-[(2Z)-2-(7-amino-1-oxo-3-sulfonatonaphthalen-2-ylidene)hydrazinyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylate |
| SMILES | Nc1ccc2c(c1)C(=O)/C(=N/Nc1ccc(-c3ccc(N/N=C4/C=CC(=O)C(C(=O)[O-])=C4)cc3)cc1)C(S(=O)(=O)[O-])=C2.[Na+].[Na+] |
| InChI | InChI=1S/C29H21N5O7S.2Na/c30-19-6-1-18-13-26(42(39,40)41)27(28(36)23(18)14-19)34-32-21-9-4-17(5-10-21)16-2-7-20(8-3-16)31-33-22-11-12-25(35)24(15-22)29(37)38;;/h1-15,31-32H,30H2,(H,37,38)(H,39,40,41);;/q;2*+1/p-2/b33-22-,34-27+;; |
| InChIKey | AWTOFMYNXWEQQW-OEUVJJBVSA-L |
| XLogP | -3.92 |
| TPSA | 206.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.55 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|