C108H104N8O16Zn — CID 22835024
CID 22835024 (PubChem CID 22835024) has the molecular formula C108H104N8O16Zn and a molecular weight of 1835.45 g/mol.
| Compound Name | CID 22835024 |
|---|---|
| PubChem CID | 22835024 |
| Molecular Formula | C108H104N8O16Zn |
| Molecular Weight | 1835.45 g/mol |
| Exact Mass | 1832.69 |
| IUPAC Name | — |
| SMILES | CCCCCC1c2cc3c4c5c2OCOc2c1cc1c6c2CNC(=O)COc2ccccc2-c2c7nc(c8c9ccc([n-]9)c(c9nc(c(c%10ccc2[n-]%10)-c2ccccc2OCC(=O)NC5)C=C9)-c2ccccc2OCC(=O)NCc2c(c(cc5c2OCOc2c(cc(c(c2CNC(=O)COc2ccccc2-8)OCO6)C1CCCCC)C5CCCCC)C3CCCCC)OCO4)C=C7.[Zn+2] |
| InChI | InChI=1S/C108H106N8O16.Zn/c1-5-9-13-25-61-69-45-71-62(26-14-10-6-2)73-47-75-64(28-16-12-8-4)76-48-74-63(27-15-11-7-3)72-46-70(61)102-78-50-110-94(118)54-122-90-34-22-18-30-66(90)98-82-38-37-81(113-82)97-65-29-17-21-33-89(65)121-53-93(117)109-49-77(101(69)125-57-126-102)103(71)127-58-129-105(73)79-51-111-95(119)55-123-91-35-23-19-31-67(91)99(85-41-39-83(97)114-85)87-43-44-88(116-87)100(86-42-40-84(98)115-86)68-32-20-24-36-92(68)124-56-96(120)112-52-80(106(74)130-59-128-104(72)78)108(76)132-60-131-107(75)79;/h17-24,29-48,61-64H,5-16,25-28,49-60H2,1-4H3,(H6,109,110,111,112,113,114,115,116,117,118,119,120);/q;+2/p-2/b97-81-,97-83-,98-82+,98-84-,99-85+,99-87-,100-86+,100-88+; |
| InChIKey | MOWTWIJJGNIWGI-HNDLKRMXSA-L |
| XLogP | 20.38 |
| TPSA | 281.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 133 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1835.45 |
| LogP ≤ 5 | 20.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|