About CID 22835143
CID 22835143 (PubChem CID 22835143) has the molecular formula C92H78N8O14Zn
and a molecular weight of 1585.07 g/mol.
Molecular Properties
| Compound Name | CID 22835143 |
| PubChem CID | 22835143 |
| Molecular Formula | C92H78N8O14Zn |
| Molecular Weight | 1585.07 g/mol |
| Exact Mass | 1582.49 |
| IUPAC Name | — |
| SMILES | O=C1N2Cc3c4ccc5c3CN3C(=O)N6Cc7c8ccc(c7CN1C6(c1ccccc1)C23c1ccccc1)OCCOCCOc1cccc(c1)-c1c2nc(c(c3ccc([n-]3)c(c3nc(c(c6ccc1[n-]6)-c1cccc(c1)OCCOCCO8)C=C3)-c1cccc(c1)OCCOCCO5)-c1cccc(c1)OCCOCCO4)C=C2.[Zn+2] |
| InChI | InChI=1S/C92H78N8O14.Zn/c101-89-97-55-69-70-56-98-90(102)100-58-72-71(57-99(89)92(100,64-17-5-2-6-18-64)91(97,98)63-15-3-1-4-16-63)83-33-34-84(72)114-50-42-106-38-46-110-68-22-10-14-62(54-68)88-76-26-25-75(94-76)87(61-13-9-21-67(53-61)109-45-37-105-41-49-113-83)79-29-27-77(95-79)85-59-11-7-19-65(51-59)107-43-35-103-39-47-111-81(69)31-32-82(70)112-48-40-104-36-44-108-66-20-8-12-60(52-66)86(74-24-23-73(85)93-74)78-28-30-80(88)96-78;/h1-34,51-54H,35-50,55-58H2;/q-2;+2/b85-73-,85-77-,86-74-,86-78+,87-75+,87-79-,88-76-,88-80-; |
| InChIKey | QELGAHHKMWJKSB-WPBYIUKPSA-N |
| XLogP | 15.33 |
| TPSA | 211.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 115 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1585.07 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22835143 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22835143?
The IUPAC name of CID 22835143 (CID 22835143) is not available.
What is the SMILES notation for CID 22835143?
The canonical SMILES for CID 22835143 is O=C1N2Cc3c4ccc5c3CN3C(=O)N6Cc7c8ccc(c7CN1C6(c1ccccc1)C23c1ccccc1)OCCOCCOc1cccc(c1)-c1c2nc(c(c3ccc([n-]3)c(c3nc(c(c6ccc1[n-]6)-c1cccc(c1)OCCOCCO8)C=C3)-c1cccc(c1)OCCOCCO5)-c1cccc(c1)OCCOCCO4)C=C2.[Zn+2].
What is the InChIKey of CID 22835143?
The InChIKey is QELGAHHKMWJKSB-WPBYIUKPSA-N. The full InChI is InChI=1S/C92H78N8O14.Zn/c101-89-97-55-69-70-56-98-90(102)100-58-72-71(57-99(89)92(100,64-17-5-2-6-18-64)91(97,98)63-15-3-1-4-16-63)83-33-34-84(72)114-50-42-106-38-46-110-68-22-10-14-62(54-68)88-76-26-25-75(94-76)87(61-13-9-21-67(53-61)109-45-37-105-41-49-113-83)79-29-27-77(95-79)85-59-11-7-19-65(51-59)107-43-35-103-39-47-111-81(69)31-32-82(70)112-48-40-104-36-44-108-66-20-8-12-60(52-66)86(74-24-23-73(85)93-74)78-28-30-80(88)96-78;/h1-34,51-54H,35-50,55-58H2;/q-2;+2/b85-73-,85-77-,86-74-,86-78+,87-75+,87-79-,88-76-,88-80-;.
What are the key properties of CID 22835143?
CID 22835143 has a molecular weight of 1585.07 g/mol, XLogP of 15.33, 2 rotatable bonds, 0 hydrogen bond donors, and 16 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22835143 is sourced from PubChem (CID 22835143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).