C21H22F3NO7 — CID 22836522
(1R,9R,17S)-5-hydroxy-4,13-dimethoxy-17-methyl-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,10,13-pentaen-12-one;2,2,2-trifluoroacetic acid (PubChem CID 22836522) has the molecular formula C21H22F3NO7 and a molecular weight of 457.40 g/mol. Its IUPAC name is (1R,9R,17S)-5-hydroxy-4,13-dimethoxy-17-methyl-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,10,13-pentaen-12-one;2,2,2-trifluoroacetic acid.
| Compound Name | (1R,9R,17S)-5-hydroxy-4,13-dimethoxy-17-methyl-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,10,13-pentaen-12-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22836522 |
| Molecular Formula | C21H22F3NO7 |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | (1R,9R,17S)-5-hydroxy-4,13-dimethoxy-17-methyl-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,10,13-pentaen-12-one;2,2,2-trifluoroacetic acid |
| SMILES | COC1=C[C@]23CC[N@+](C)([O-])[C@H](Cc4cc(O)c(OC)cc42)C3=CC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H21NO5.C2HF3O2/c1-20(23)5-4-19-10-18(25-3)16(22)8-13(19)14(20)6-11-7-15(21)17(24-2)9-12(11)19;3-2(4,5)1(6)7/h7-10,14,21H,4-6H2,1-3H3;(H,6,7)/t14-,19-,20+;/m1./s1 |
| InChIKey | BFPDDVBMRCKPMH-XXZPFRKRSA-N |
| XLogP | 2.58 |
| TPSA | 116.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|