About methyl (2R)-2-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxoazepan-1-yl]-3-phenylpropanoate
methyl (2R)-2-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxoazepan-1-yl]-3-phenylpropanoate (PubChem CID 22836880) has the molecular formula C24H24N2O5
and a molecular weight of 420.47 g/mol. Its IUPAC name is methyl (2R)-2-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxoazepan-1-yl]-3-phenylpropanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxoazepan-1-yl]-3-phenylpropanoate |
| PubChem CID | 22836880 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | methyl (2R)-2-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxoazepan-1-yl]-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)N1CCCC[C@H](N2C(=O)c3ccccc3C2=O)C1=O |
| InChI | InChI=1S/C24H24N2O5/c1-31-24(30)20(15-16-9-3-2-4-10-16)25-14-8-7-13-19(23(25)29)26-21(27)17-11-5-6-12-18(17)22(26)28/h2-6,9-12,19-20H,7-8,13-15H2,1H3/t19-,20+/m0/s1 |
| InChIKey | MVRGJSVXTXSNGH-VQTJNVASSA-N |
| XLogP | 2.45 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R)-2-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxoazepan-1-yl]-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxoazepan-1-yl]-3-phenylpropanoate?
The IUPAC name of methyl (2R)-2-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxoazepan-1-yl]-3-phenylpropanoate (CID 22836880) is methyl (2R)-2-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxoazepan-1-yl]-3-phenylpropanoate.
What is the SMILES notation for methyl (2R)-2-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxoazepan-1-yl]-3-phenylpropanoate?
The canonical SMILES for methyl (2R)-2-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxoazepan-1-yl]-3-phenylpropanoate is COC(=O)[C@@H](Cc1ccccc1)N1CCCC[C@H](N2C(=O)c3ccccc3C2=O)C1=O.
What is the InChIKey of methyl (2R)-2-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxoazepan-1-yl]-3-phenylpropanoate?
The InChIKey is MVRGJSVXTXSNGH-VQTJNVASSA-N. The full InChI is InChI=1S/C24H24N2O5/c1-31-24(30)20(15-16-9-3-2-4-10-16)25-14-8-7-13-19(23(25)29)26-21(27)17-11-5-6-12-18(17)22(26)28/h2-6,9-12,19-20H,7-8,13-15H2,1H3/t19-,20+/m0/s1.
What are the key properties of methyl (2R)-2-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxoazepan-1-yl]-3-phenylpropanoate?
methyl (2R)-2-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxoazepan-1-yl]-3-phenylpropanoate has a molecular weight of 420.47 g/mol, XLogP of 2.45, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxoazepan-1-yl]-3-phenylpropanoate is sourced from PubChem (CID 22836880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).