C24H24N2O5 — CID 22836880
methyl (2R)-2-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxoazepan-1-yl]-3-phenylpropanoate (PubChem CID 22836880) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is methyl (2R)-2-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxoazepan-1-yl]-3-phenylpropanoate.
| Compound Name | methyl (2R)-2-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxoazepan-1-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 22836880 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | methyl (2R)-2-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxoazepan-1-yl]-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)N1CCCC[C@H](N2C(=O)c3ccccc3C2=O)C1=O |
| InChI | InChI=1S/C24H24N2O5/c1-31-24(30)20(15-16-9-3-2-4-10-16)25-14-8-7-13-19(23(25)29)26-21(27)17-11-5-6-12-18(17)22(26)28/h2-6,9-12,19-20H,7-8,13-15H2,1H3/t19-,20+/m0/s1 |
| InChIKey | MVRGJSVXTXSNGH-VQTJNVASSA-N |
| XLogP | 2.45 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|