C34H48N2O4Ti+2 — CID 22836918
1-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;bis(4-aminobenzoic acid);titanium(2+) (PubChem CID 22836918) has the molecular formula C34H48N2O4Ti+2 and a molecular weight of 596.64 g/mol. Its IUPAC name is 1-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;bis(4-aminobenzoic acid);titanium(2+).
| Compound Name | 1-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;bis(4-aminobenzoic acid);titanium(2+) |
|---|---|
| PubChem CID | 22836918 |
| Molecular Formula | C34H48N2O4Ti+2 |
| Molecular Weight | 596.64 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | 1-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;bis(4-aminobenzoic acid);titanium(2+) |
| SMILES | C1CCC2C(C1)CCC2CCC1CCC2CCCCC21.Nc1ccc(C(=O)O)cc1.Nc1ccc(C(=O)O)cc1.[Ti+2] |
| InChI | InChI=1S/C20H34.2C7H7NO2.Ti/c1-3-7-19-15(5-1)9-11-17(19)13-14-18-12-10-16-6-2-4-8-20(16)18;2*8-6-3-1-5(2-4-6)7(9)10;/h15-20H,1-14H2;2*1-4H,8H2,(H,9,10);/q;;;+2 |
| InChIKey | XUZRVCLMDNJYMM-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.64 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|