C29H47NO2 — CID 22837115
(5R)-5-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-N,N-diethylhexanamide (PubChem CID 22837115) has the molecular formula C29H47NO2 and a molecular weight of 441.70 g/mol. Its IUPAC name is (5R)-5-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-N,N-diethylhexanamide.
| Compound Name | (5R)-5-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-N,N-diethylhexanamide |
|---|---|
| PubChem CID | 22837115 |
| Molecular Formula | C29H47NO2 |
| Molecular Weight | 441.70 g/mol |
| Exact Mass | 441.36 |
| IUPAC Name | (5R)-5-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-N,N-diethylhexanamide |
| SMILES | CCN(CC)C(=O)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H47NO2/c1-6-30(7-2)27(32)10-8-9-20(3)24-13-14-25-23-12-11-21-19-22(31)15-17-28(21,4)26(23)16-18-29(24,25)5/h19-20,23-26H,6-18H2,1-5H3/t20-,23+,24-,25+,26+,28+,29-/m1/s1 |
| InChIKey | TYPCAQGRTXLMBO-RLGJHICRSA-N |
| XLogP | 6.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.70 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |