C20H32Cl2N2O4S — CID 22839032
1,2-dichlorobenzene;methanesulfonic acid;N-methyl-N-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]acetamide (PubChem CID 22839032) has the molecular formula C20H32Cl2N2O4S and a molecular weight of 467.46 g/mol. Its IUPAC name is 1,2-dichlorobenzene;methanesulfonic acid;N-methyl-N-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]acetamide.
| Compound Name | 1,2-dichlorobenzene;methanesulfonic acid;N-methyl-N-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 22839032 |
| Molecular Formula | C20H32Cl2N2O4S |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 1,2-dichlorobenzene;methanesulfonic acid;N-methyl-N-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]acetamide |
| SMILES | CC(=O)N(C)[C@@H]1CCCC[C@H]1N1CCCC1.CS(=O)(=O)O.Clc1ccccc1Cl |
| InChI | InChI=1S/C13H24N2O.C6H4Cl2.CH4O3S/c1-11(16)14(2)12-7-3-4-8-13(12)15-9-5-6-10-15;7-5-3-1-2-4-6(5)8;1-5(2,3)4/h12-13H,3-10H2,1-2H3;1-4H;1H3,(H,2,3,4)/t12-,13-;;/m1../s1 |
| InChIKey | GZLHPIASAQBIRD-SNFSYSBXSA-N |
| XLogP | 4.37 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|