C12H24O11 — CID 22839085
(2R,3R,4R,5S)-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexane-1,2,3,4,5,6-hexol (PubChem CID 22839085) has the molecular formula C12H24O11 and a molecular weight of 344.31 g/mol. Its IUPAC name is (2R,3R,4R,5S)-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexane-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3R,4R,5S)-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 22839085 |
| Molecular Formula | C12H24O11 |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (2R,3R,4R,5S)-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexane-1,2,3,4,5,6-hexol |
| SMILES | OC[C@@H](O)[C@@](O)([C@H](O)[C@@H](O)CO)[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H24O11/c13-1-4(16)10(21)12(22,6(17)3-15)11-9(20)8(19)7(18)5(2-14)23-11/h4-11,13-22H,1-3H2/t4-,5+,6+,7-,8-,9+,10+,11+,12+/m0/s1 |
| InChIKey | AUSUXGHKJAVNSZ-NMYSYPRZSA-N |
| XLogP | -6.37 |
| TPSA | 211.53 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | -6.37 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |