C24H46O3Si2 — CID 22839331
(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-4-ethenyl-4-trimethylsilyloxyoct-1-enyl]cyclopenten-1-ol (PubChem CID 22839331) has the molecular formula C24H46O3Si2 and a molecular weight of 438.80 g/mol. Its IUPAC name is (3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-4-ethenyl-4-trimethylsilyloxyoct-1-enyl]cyclopenten-1-ol.
| Compound Name | (3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-4-ethenyl-4-trimethylsilyloxyoct-1-enyl]cyclopenten-1-ol |
|---|---|
| PubChem CID | 22839331 |
| Molecular Formula | C24H46O3Si2 |
| Molecular Weight | 438.80 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-4-ethenyl-4-trimethylsilyloxyoct-1-enyl]cyclopenten-1-ol |
| SMILES | C=CC(C/C=C/[C@@H]1C=C(O)C[C@H]1O[Si](C)(C)C(C)(C)C)(CCCC)O[Si](C)(C)C |
| InChI | InChI=1S/C24H46O3Si2/c1-11-13-16-24(12-2,27-28(6,7)8)17-14-15-20-18-21(25)19-22(20)26-29(9,10)23(3,4)5/h12,14-15,18,20,22,25H,2,11,13,16-17,19H2,1,3-10H3/b15-14+/t20-,22-,24?/m1/s1 |
| InChIKey | SRCFVGWHLONKIF-DWOHIFKMSA-N |
| XLogP | 7.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.80 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|