About [(6S,9R)-6-(dimethylamino)-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl] 4-methylbenzoate
[(6S,9R)-6-(dimethylamino)-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl] 4-methylbenzoate (PubChem CID 22839600) has the molecular formula C19H28N2O2
and a molecular weight of 316.44 g/mol. Its IUPAC name is [(6S,9R)-6-(dimethylamino)-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl] 4-methylbenzoate.
Molecular Properties
| Compound Name | [(6S,9R)-6-(dimethylamino)-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl] 4-methylbenzoate |
| PubChem CID | 22839600 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | [(6S,9R)-6-(dimethylamino)-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O[C@@H]2C3CC[C@H](N(C)C)C2CN(C)C3)cc1 |
| InChI | InChI=1S/C19H28N2O2/c1-13-5-7-14(8-6-13)19(22)23-18-15-9-10-17(20(2)3)16(18)12-21(4)11-15/h5-8,15-18H,9-12H2,1-4H3/t15?,16?,17-,18+/m0/s1 |
| InChIKey | LTWQRSOVJRUADV-ZGUYJTEBSA-N |
| XLogP | 2.42 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(6S,9R)-6-(dimethylamino)-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6S,9R)-6-(dimethylamino)-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl] 4-methylbenzoate?
The IUPAC name of [(6S,9R)-6-(dimethylamino)-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl] 4-methylbenzoate (CID 22839600) is [(6S,9R)-6-(dimethylamino)-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl] 4-methylbenzoate.
What is the SMILES notation for [(6S,9R)-6-(dimethylamino)-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl] 4-methylbenzoate?
The canonical SMILES for [(6S,9R)-6-(dimethylamino)-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl] 4-methylbenzoate is Cc1ccc(C(=O)O[C@@H]2C3CC[C@H](N(C)C)C2CN(C)C3)cc1.
What is the InChIKey of [(6S,9R)-6-(dimethylamino)-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl] 4-methylbenzoate?
The InChIKey is LTWQRSOVJRUADV-ZGUYJTEBSA-N. The full InChI is InChI=1S/C19H28N2O2/c1-13-5-7-14(8-6-13)19(22)23-18-15-9-10-17(20(2)3)16(18)12-21(4)11-15/h5-8,15-18H,9-12H2,1-4H3/t15?,16?,17-,18+/m0/s1.
What are the key properties of [(6S,9R)-6-(dimethylamino)-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl] 4-methylbenzoate?
[(6S,9R)-6-(dimethylamino)-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl] 4-methylbenzoate has a molecular weight of 316.44 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(6S,9R)-6-(dimethylamino)-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl] 4-methylbenzoate is sourced from PubChem (CID 22839600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).