C17H26N2O — CID 22839614
(6R,9R)-N,N,3-trimethyl-9-phenoxy-3-azabicyclo[3.3.1]nonan-6-amine (PubChem CID 22839614) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is (6R,9R)-N,N,3-trimethyl-9-phenoxy-3-azabicyclo[3.3.1]nonan-6-amine.
| Compound Name | (6R,9R)-N,N,3-trimethyl-9-phenoxy-3-azabicyclo[3.3.1]nonan-6-amine |
|---|---|
| PubChem CID | 22839614 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (6R,9R)-N,N,3-trimethyl-9-phenoxy-3-azabicyclo[3.3.1]nonan-6-amine |
| SMILES | CN1CC2CC[C@@H](N(C)C)C(C1)[C@@H]2Oc1ccccc1 |
| InChI | InChI=1S/C17H26N2O/c1-18(2)16-10-9-13-11-19(3)12-15(16)17(13)20-14-7-5-4-6-8-14/h4-8,13,15-17H,9-12H2,1-3H3/t13?,15?,16-,17-/m1/s1 |
| InChIKey | RSYUYTAYMRNTFS-OKEQZYBDSA-N |
| XLogP | 2.34 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |