C27H52O5Si2 — CID 22840026
methyl 6-[(1S,2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-formylcyclopentyl]hept-6-enoate (PubChem CID 22840026) has the molecular formula C27H52O5Si2 and a molecular weight of 512.88 g/mol. Its IUPAC name is methyl 6-[(1S,2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-formylcyclopentyl]hept-6-enoate.
| Compound Name | methyl 6-[(1S,2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-formylcyclopentyl]hept-6-enoate |
|---|---|
| PubChem CID | 22840026 |
| Molecular Formula | C27H52O5Si2 |
| Molecular Weight | 512.88 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | methyl 6-[(1S,2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-formylcyclopentyl]hept-6-enoate |
| SMILES | C=C(CCCCC(=O)OC)[C@H]1[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C=O |
| InChI | InChI=1S/C27H52O5Si2/c1-20(15-13-14-16-24(29)30-8)25-21(18-28)17-23(32-34(11,12)27(5,6)7)22(25)19-31-33(9,10)26(2,3)4/h18,21-23,25H,1,13-17,19H2,2-12H3/t21-,22+,23-,25+/m0/s1 |
| InChIKey | ZYBQPDFIBFAWBJ-ONTNHIFESA-N |
| XLogP | 7.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.88 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|