C24H38O5S — CID 22841414
2-[(1R,3aR,4S,7aR)-4-(1-ethoxyethoxy)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl 4-methylbenzenesulfonate (PubChem CID 22841414) has the molecular formula C24H38O5S and a molecular weight of 438.63 g/mol. Its IUPAC name is 2-[(1R,3aR,4S,7aR)-4-(1-ethoxyethoxy)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl 4-methylbenzenesulfonate.
| Compound Name | 2-[(1R,3aR,4S,7aR)-4-(1-ethoxyethoxy)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 22841414 |
| Molecular Formula | C24H38O5S |
| Molecular Weight | 438.63 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 2-[(1R,3aR,4S,7aR)-4-(1-ethoxyethoxy)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl 4-methylbenzenesulfonate |
| SMILES | CCOC(C)O[C@H]1CCC[C@]2(C)[C@@H](C(C)COS(=O)(=O)c3ccc(C)cc3)CC[C@@H]12 |
| InChI | InChI=1S/C24H38O5S/c1-6-27-19(4)29-23-8-7-15-24(5)21(13-14-22(23)24)18(3)16-28-30(25,26)20-11-9-17(2)10-12-20/h9-12,18-19,21-23H,6-8,13-16H2,1-5H3/t18?,19?,21-,22+,23+,24-/m1/s1 |
| InChIKey | RHXYTPQDHQEPCV-MPSRERAZSA-N |
| XLogP | 5.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|