C17H19ClO3 — CID 2284147
2-chloro-5-[2-(2-methoxyphenoxy)ethoxy]-1,3-dimethylbenzene (PubChem CID 2284147) has the molecular formula C17H19ClO3 and a molecular weight of 306.79 g/mol. Its IUPAC name is 2-chloro-5-[2-(2-methoxyphenoxy)ethoxy]-1,3-dimethylbenzene.
| Compound Name | 2-chloro-5-[2-(2-methoxyphenoxy)ethoxy]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 2284147 |
| Molecular Formula | C17H19ClO3 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-chloro-5-[2-(2-methoxyphenoxy)ethoxy]-1,3-dimethylbenzene |
| SMILES | COc1ccccc1OCCOc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C17H19ClO3/c1-12-10-14(11-13(2)17(12)18)20-8-9-21-16-7-5-4-6-15(16)19-3/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | ZGZGJMTXJSNRIW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|