C7H17N3O — CID 22841836
2-(1,1-dideuteriopentylamino)acetohydrazide (PubChem CID 22841836) has the molecular formula C7H17N3O and a molecular weight of 161.25 g/mol. Its IUPAC name is 2-(1,1-dideuteriopentylamino)acetohydrazide.
| Compound Name | 2-(1,1-dideuteriopentylamino)acetohydrazide |
|---|---|
| PubChem CID | 22841836 |
| Molecular Formula | C7H17N3O |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.15 |
| IUPAC Name | 2-(1,1-dideuteriopentylamino)acetohydrazide |
| SMILES | [2H]C([2H])(CCCC)NCC(=O)NN |
| InChI | InChI=1S/C7H17N3O/c1-2-3-4-5-9-6-7(11)10-8/h9H,2-6,8H2,1H3,(H,10,11)/i5D2 |
| InChIKey | YESKJVHQZSUSOT-BFWBPSQCSA-N |
| XLogP | -0.24 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|