About ethyl 2-[(2S,3S)-4-oxo-3-[(1R)-1-phenylmethoxycarbonyloxyethyl]azetidin-2-yl]propanoate
ethyl 2-[(2S,3S)-4-oxo-3-[(1R)-1-phenylmethoxycarbonyloxyethyl]azetidin-2-yl]propanoate (PubChem CID 22841887) has the molecular formula C18H23NO6
and a molecular weight of 349.38 g/mol. Its IUPAC name is ethyl 2-[(2S,3S)-4-oxo-3-[(1R)-1-phenylmethoxycarbonyloxyethyl]azetidin-2-yl]propanoate.
Molecular Properties
| Compound Name | ethyl 2-[(2S,3S)-4-oxo-3-[(1R)-1-phenylmethoxycarbonyloxyethyl]azetidin-2-yl]propanoate |
| PubChem CID | 22841887 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | ethyl 2-[(2S,3S)-4-oxo-3-[(1R)-1-phenylmethoxycarbonyloxyethyl]azetidin-2-yl]propanoate |
| SMILES | CCOC(=O)C(C)[C@H]1NC(=O)[C@@H]1[C@@H](C)OC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H23NO6/c1-4-23-17(21)11(2)15-14(16(20)19-15)12(3)25-18(22)24-10-13-8-6-5-7-9-13/h5-9,11-12,14-15H,4,10H2,1-3H3,(H,19,20)/t11?,12-,14-,15-/m1/s1 |
| InChIKey | KPGBQFYYOROLOE-ZJPTYJIISA-N |
| XLogP | 2.04 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[(2S,3S)-4-oxo-3-[(1R)-1-phenylmethoxycarbonyloxyethyl]azetidin-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2S,3S)-4-oxo-3-[(1R)-1-phenylmethoxycarbonyloxyethyl]azetidin-2-yl]propanoate?
The IUPAC name of ethyl 2-[(2S,3S)-4-oxo-3-[(1R)-1-phenylmethoxycarbonyloxyethyl]azetidin-2-yl]propanoate (CID 22841887) is ethyl 2-[(2S,3S)-4-oxo-3-[(1R)-1-phenylmethoxycarbonyloxyethyl]azetidin-2-yl]propanoate.
What is the SMILES notation for ethyl 2-[(2S,3S)-4-oxo-3-[(1R)-1-phenylmethoxycarbonyloxyethyl]azetidin-2-yl]propanoate?
The canonical SMILES for ethyl 2-[(2S,3S)-4-oxo-3-[(1R)-1-phenylmethoxycarbonyloxyethyl]azetidin-2-yl]propanoate is CCOC(=O)C(C)[C@H]1NC(=O)[C@@H]1[C@@H](C)OC(=O)OCc1ccccc1.
What is the InChIKey of ethyl 2-[(2S,3S)-4-oxo-3-[(1R)-1-phenylmethoxycarbonyloxyethyl]azetidin-2-yl]propanoate?
The InChIKey is KPGBQFYYOROLOE-ZJPTYJIISA-N. The full InChI is InChI=1S/C18H23NO6/c1-4-23-17(21)11(2)15-14(16(20)19-15)12(3)25-18(22)24-10-13-8-6-5-7-9-13/h5-9,11-12,14-15H,4,10H2,1-3H3,(H,19,20)/t11?,12-,14-,15-/m1/s1.
What are the key properties of ethyl 2-[(2S,3S)-4-oxo-3-[(1R)-1-phenylmethoxycarbonyloxyethyl]azetidin-2-yl]propanoate?
ethyl 2-[(2S,3S)-4-oxo-3-[(1R)-1-phenylmethoxycarbonyloxyethyl]azetidin-2-yl]propanoate has a molecular weight of 349.38 g/mol, XLogP of 2.04, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2S,3S)-4-oxo-3-[(1R)-1-phenylmethoxycarbonyloxyethyl]azetidin-2-yl]propanoate is sourced from PubChem (CID 22841887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).