C22H32N4O3 — CID 22841986
[(3aS,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl]carbamoyl N-cyclohexyl-N-methylcarbamate (PubChem CID 22841986) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is [(3aS,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl]carbamoyl N-cyclohexyl-N-methylcarbamate.
| Compound Name | [(3aS,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl]carbamoyl N-cyclohexyl-N-methylcarbamate |
|---|---|
| PubChem CID | 22841986 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | [(3aS,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl]carbamoyl N-cyclohexyl-N-methylcarbamate |
| SMILES | CN(C(=O)OC(=O)Nc1ccc2c(c1)[C@]1(C)CCN(C)[C@H]1N2C)C1CCCCC1 |
| InChI | InChI=1S/C22H32N4O3/c1-22-12-13-24(2)19(22)26(4)18-11-10-15(14-17(18)22)23-20(27)29-21(28)25(3)16-8-6-5-7-9-16/h10-11,14,16,19H,5-9,12-13H2,1-4H3,(H,23,27)/t19-,22-/m0/s1 |
| InChIKey | HYZROYLKKRFSMZ-UGKGYDQZSA-N |
| XLogP | 3.99 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|