C18H24N2O5 — CID 22842791
cis-(1R,2S)-2-[[1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]-methylcarbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 22842791) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is cis-(1R,2S)-2-[[1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]-methylcarbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-2-[[1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]-methylcarbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 22842791 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | cis-(1R,2S)-2-[[1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]-methylcarbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | CN(C(=O)[C@H]1CCCC[C@H]1C(=O)O)C(Cc1ccccc1)C(=O)NO |
| InChI | InChI=1S/C18H24N2O5/c1-20(17(22)13-9-5-6-10-14(13)18(23)24)15(16(21)19-25)11-12-7-3-2-4-8-12/h2-4,7-8,13-15,25H,5-6,9-11H2,1H3,(H,19,21)(H,23,24)/t13-,14+,15?/m0/s1 |
| InChIKey | PQICHCBLKCLEAG-SNTRVMSOSA-N |
| XLogP | 1.45 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|