benzyl (2S,3R)-2-(dibenzylamino)-3-fluorobutanoate

C25H26FNO2 — CID 22842816

IUPACbenzyl (2S,3R)-2-(dibenzylamino)-3-fluorobutanoate
SMILESC[C@@H](F)[C@H](C(=O)OCc1ccccc1)N(Cc1ccccc1)Cc1ccccc1
InChIInChI=1S/C25H26FNO2/c1-20(26)24(25(28)29-19-23-15-9-4-10-16-23)27(17-21-11-5-2-6-12-21)18-22-13-7-3-8-14-22/h2-16,20,24H,17-19H2,1H3/t20-,24-/m1/s1
InChIKeyOKMGGBUJSWYSRE-HYBUGGRVSA-N
MW391.49 g/mol
LogP5.16
Rot. Bonds9

About benzyl (2S,3R)-2-(dibenzylamino)-3-fluorobutanoate

benzyl (2S,3R)-2-(dibenzylamino)-3-fluorobutanoate (PubChem CID 22842816) has the molecular formula C25H26FNO2 and a molecular weight of 391.49 g/mol. Its IUPAC name is benzyl (2S,3R)-2-(dibenzylamino)-3-fluorobutanoate.

Molecular Properties

Compound Namebenzyl (2S,3R)-2-(dibenzylamino)-3-fluorobutanoate
PubChem CID22842816
Molecular FormulaC25H26FNO2
Molecular Weight391.49 g/mol
Exact Mass391.19
IUPAC Namebenzyl (2S,3R)-2-(dibenzylamino)-3-fluorobutanoate
SMILESC[C@@H](F)[C@H](C(=O)OCc1ccccc1)N(Cc1ccccc1)Cc1ccccc1
InChIInChI=1S/C25H26FNO2/c1-20(26)24(25(28)29-19-23-15-9-4-10-16-23)27(17-21-11-5-2-6-12-21)18-22-13-7-3-8-14-22/h2-16,20,24H,17-19H2,1H3/t20-,24-/m1/s1
InChIKeyOKMGGBUJSWYSRE-HYBUGGRVSA-N
XLogP5.16
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms29
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500391.49
LogP ≤ 55.16
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze benzyl (2S,3R)-2-(dibenzylamino)-3-fluorobutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl (2S,3R)-2-(dibenzylamino)-3-fluorobutanoate?
The IUPAC name of benzyl (2S,3R)-2-(dibenzylamino)-3-fluorobutanoate (CID 22842816) is benzyl (2S,3R)-2-(dibenzylamino)-3-fluorobutanoate.
What is the SMILES notation for benzyl (2S,3R)-2-(dibenzylamino)-3-fluorobutanoate?
The canonical SMILES for benzyl (2S,3R)-2-(dibenzylamino)-3-fluorobutanoate is C[C@@H](F)[C@H](C(=O)OCc1ccccc1)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of benzyl (2S,3R)-2-(dibenzylamino)-3-fluorobutanoate?
The InChIKey is OKMGGBUJSWYSRE-HYBUGGRVSA-N. The full InChI is InChI=1S/C25H26FNO2/c1-20(26)24(25(28)29-19-23-15-9-4-10-16-23)27(17-21-11-5-2-6-12-21)18-22-13-7-3-8-14-22/h2-16,20,24H,17-19H2,1H3/t20-,24-/m1/s1.
What are the key properties of benzyl (2S,3R)-2-(dibenzylamino)-3-fluorobutanoate?
benzyl (2S,3R)-2-(dibenzylamino)-3-fluorobutanoate has a molecular weight of 391.49 g/mol, XLogP of 5.16, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (2S,3R)-2-(dibenzylamino)-3-fluorobutanoate is sourced from PubChem (CID 22842816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).