C20H28F2O5 — CID 22842862
(3aR,4R,5R,6aS)-4-[(E)-4,4-difluoro-5-oxooct-2-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 22842862) has the molecular formula C20H28F2O5 and a molecular weight of 386.44 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(E)-4,4-difluoro-5-oxooct-2-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-[(E)-4,4-difluoro-5-oxooct-2-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 22842862 |
| Molecular Formula | C20H28F2O5 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(E)-4,4-difluoro-5-oxooct-2-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCC(=O)C(F)(F)/C=C/C[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C20H28F2O5/c1-2-6-17(23)20(21,22)9-5-7-13-14-11-18(24)26-16(14)12-15(13)27-19-8-3-4-10-25-19/h5,9,13-16,19H,2-4,6-8,10-12H2,1H3/b9-5+/t13-,14-,15-,16+,19?/m1/s1 |
| InChIKey | BXSCNNADPQDDOK-HYPYWDQKSA-N |
| XLogP | 3.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|