C10H15NO2 — CID 22842892
2-[(2R,4S,6S)-2-methyl-6-prop-2-enyl-1,3-dioxan-4-yl]acetonitrile (PubChem CID 22842892) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 2-[(2R,4S,6S)-2-methyl-6-prop-2-enyl-1,3-dioxan-4-yl]acetonitrile.
| Compound Name | 2-[(2R,4S,6S)-2-methyl-6-prop-2-enyl-1,3-dioxan-4-yl]acetonitrile |
|---|---|
| PubChem CID | 22842892 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 2-[(2R,4S,6S)-2-methyl-6-prop-2-enyl-1,3-dioxan-4-yl]acetonitrile |
| SMILES | C=CC[C@H]1C[C@H](CC#N)O[C@H](C)O1 |
| InChI | InChI=1S/C10H15NO2/c1-3-4-9-7-10(5-6-11)13-8(2)12-9/h3,8-10H,1,4-5,7H2,2H3/t8-,9+,10+/m1/s1 |
| InChIKey | NKJABTDXHBAVCS-UTLUCORTSA-N |
| XLogP | 2.00 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|