C14H14ClNO — CID 22843614
(1S,2R,3S)-3-amino-1-chloro-1,2,3,4-tetrahydrophenanthren-2-ol (PubChem CID 22843614) has the molecular formula C14H14ClNO and a molecular weight of 247.73 g/mol. Its IUPAC name is (1S,2R,3S)-3-amino-1-chloro-1,2,3,4-tetrahydrophenanthren-2-ol.
| Compound Name | (1S,2R,3S)-3-amino-1-chloro-1,2,3,4-tetrahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 22843614 |
| Molecular Formula | C14H14ClNO |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | (1S,2R,3S)-3-amino-1-chloro-1,2,3,4-tetrahydrophenanthren-2-ol |
| SMILES | N[C@H]1Cc2c(ccc3ccccc23)[C@H](Cl)[C@@H]1O |
| InChI | InChI=1S/C14H14ClNO/c15-13-10-6-5-8-3-1-2-4-9(8)11(10)7-12(16)14(13)17/h1-6,12-14,17H,7,16H2/t12-,13-,14+/m0/s1 |
| InChIKey | PWMZGRIILGHFRV-MELADBBJSA-N |
| XLogP | 2.36 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|