About cyclohexyl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanone
cyclohexyl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanone (PubChem CID 22843766) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is cyclohexyl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanone.
Molecular Properties
| Compound Name | cyclohexyl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanone |
| PubChem CID | 22843766 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | cyclohexyl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanone |
| SMILES | CC1(C)OC[C@@H](C(=O)C2CCCCC2)O1 |
| InChI | InChI=1S/C12H20O3/c1-12(2)14-8-10(15-12)11(13)9-6-4-3-5-7-9/h9-10H,3-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | YMBUYWRDVOHVCS-JTQLQIEISA-N |
| XLogP | 2.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanone?
The IUPAC name of cyclohexyl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanone (CID 22843766) is cyclohexyl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanone.
What is the SMILES notation for cyclohexyl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanone?
The canonical SMILES for cyclohexyl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanone is CC1(C)OC[C@@H](C(=O)C2CCCCC2)O1.
What is the InChIKey of cyclohexyl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanone?
The InChIKey is YMBUYWRDVOHVCS-JTQLQIEISA-N. The full InChI is InChI=1S/C12H20O3/c1-12(2)14-8-10(15-12)11(13)9-6-4-3-5-7-9/h9-10H,3-8H2,1-2H3/t10-/m0/s1.
What are the key properties of cyclohexyl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanone?
cyclohexyl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanone has a molecular weight of 212.29 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanone is sourced from PubChem (CID 22843766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).