C13H22O — CID 22843968
(4aR,8aS)-4a,8,8-trimethyl-3,4,5,6,7,8a-hexahydro-2H-naphthalen-1-one (PubChem CID 22843968) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is (4aR,8aS)-4a,8,8-trimethyl-3,4,5,6,7,8a-hexahydro-2H-naphthalen-1-one.
| Compound Name | (4aR,8aS)-4a,8,8-trimethyl-3,4,5,6,7,8a-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 22843968 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (4aR,8aS)-4a,8,8-trimethyl-3,4,5,6,7,8a-hexahydro-2H-naphthalen-1-one |
| SMILES | CC1(C)CCC[C@]2(C)CCCC(=O)[C@@H]12 |
| InChI | InChI=1S/C13H22O/c1-12(2)7-5-9-13(3)8-4-6-10(14)11(12)13/h11H,4-9H2,1-3H3/t11-,13-/m0/s1 |
| InChIKey | GIWMQDLRRWEQNE-AAEUAGOBSA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |