C28H52O6Si — CID 22844346
2-[(1S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(oxan-2-yloxy)-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]acetaldehyde (PubChem CID 22844346) has the molecular formula C28H52O6Si and a molecular weight of 512.80 g/mol. Its IUPAC name is 2-[(1S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(oxan-2-yloxy)-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]acetaldehyde.
| Compound Name | 2-[(1S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(oxan-2-yloxy)-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]acetaldehyde |
|---|---|
| PubChem CID | 22844346 |
| Molecular Formula | C28H52O6Si |
| Molecular Weight | 512.80 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | 2-[(1S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(oxan-2-yloxy)-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]acetaldehyde |
| SMILES | CCCCCC1(CCC2C(OC3CCCCO3)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2CC=O)OCCO1 |
| InChI | InChI=1S/C28H52O6Si/c1-7-8-10-15-28(31-19-20-32-28)16-13-22-23(14-17-29)25(34-35(5,6)27(2,3)4)21-24(22)33-26-12-9-11-18-30-26/h17,22-26H,7-16,18-21H2,1-6H3/t22?,23-,24?,25+,26?/m0/s1 |
| InChIKey | JZZQSJAGESEZCR-NEPBHWBVSA-N |
| XLogP | 6.62 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.80 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|