C29H54O7Si — CID 22844351
methyl 2-[(1S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(oxan-2-yloxy)-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]acetate (PubChem CID 22844351) has the molecular formula C29H54O7Si and a molecular weight of 542.83 g/mol. Its IUPAC name is methyl 2-[(1S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(oxan-2-yloxy)-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]acetate.
| Compound Name | methyl 2-[(1S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(oxan-2-yloxy)-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 22844351 |
| Molecular Formula | C29H54O7Si |
| Molecular Weight | 542.83 g/mol |
| Exact Mass | 542.36 |
| IUPAC Name | methyl 2-[(1S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(oxan-2-yloxy)-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]acetate |
| SMILES | CCCCCC1(CCC2C(OC3CCCCO3)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2CC(=O)OC)OCCO1 |
| InChI | InChI=1S/C29H54O7Si/c1-8-9-11-15-29(33-18-19-34-29)16-14-22-23(20-26(30)31-5)25(36-37(6,7)28(2,3)4)21-24(22)35-27-13-10-12-17-32-27/h22-25,27H,8-21H2,1-7H3/t22?,23-,24?,25+,27?/m0/s1 |
| InChIKey | YOGBGMLXUFLAQD-GHRUZZEOSA-N |
| XLogP | 6.59 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.83 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|