C24H39NOSi — CID 22844414
(2E,4E,8E,12E)-5,9,13-trimethyl-2-propan-2-yl-1-trimethylsilyloxycyclotetradeca-2,4,8,12-tetraene-1-carbonitrile (PubChem CID 22844414) has the molecular formula C24H39NOSi and a molecular weight of 385.67 g/mol. Its IUPAC name is (2E,4E,8E,12E)-5,9,13-trimethyl-2-propan-2-yl-1-trimethylsilyloxycyclotetradeca-2,4,8,12-tetraene-1-carbonitrile.
| Compound Name | (2E,4E,8E,12E)-5,9,13-trimethyl-2-propan-2-yl-1-trimethylsilyloxycyclotetradeca-2,4,8,12-tetraene-1-carbonitrile |
|---|---|
| PubChem CID | 22844414 |
| Molecular Formula | C24H39NOSi |
| Molecular Weight | 385.67 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | (2E,4E,8E,12E)-5,9,13-trimethyl-2-propan-2-yl-1-trimethylsilyloxycyclotetradeca-2,4,8,12-tetraene-1-carbonitrile |
| SMILES | C/C1=C\C=C(/C(C)C)C(C#N)(O[Si](C)(C)C)C/C(C)=C/CC/C(C)=C/CC1 |
| InChI | InChI=1S/C24H39NOSi/c1-19(2)23-16-15-21(4)13-9-11-20(3)12-10-14-22(5)17-24(23,18-25)26-27(6,7)8/h11,14-16,19H,9-10,12-13,17H2,1-8H3/b20-11+,21-15+,22-14+,23-16+ |
| InChIKey | XMHLLFMVLNNBOA-FWFWHXBVSA-N |
| XLogP | 7.49 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.67 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|