C38H54N2O6 — CID 22844483
[(1S)-2-[[4-phenyl-2-(3-phenylpropyl)pentanoyl]amino]cyclohexyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate (PubChem CID 22844483) has the molecular formula C38H54N2O6 and a molecular weight of 634.86 g/mol. Its IUPAC name is [(1S)-2-[[4-phenyl-2-(3-phenylpropyl)pentanoyl]amino]cyclohexyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate.
| Compound Name | [(1S)-2-[[4-phenyl-2-(3-phenylpropyl)pentanoyl]amino]cyclohexyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 22844483 |
| Molecular Formula | C38H54N2O6 |
| Molecular Weight | 634.86 g/mol |
| Exact Mass | 634.40 |
| IUPAC Name | [(1S)-2-[[4-phenyl-2-(3-phenylpropyl)pentanoyl]amino]cyclohexyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
| SMILES | CC(CC(CCCc1ccccc1)C(=O)NC1CCCC[C@@H]1OC(=O)CCNC(=O)C1OC(C)(C)OCC1(C)C)c1ccccc1 |
| InChI | InChI=1S/C38H54N2O6/c1-27(29-18-10-7-11-19-29)25-30(20-14-17-28-15-8-6-9-16-28)35(42)40-31-21-12-13-22-32(31)45-33(41)23-24-39-36(43)34-37(2,3)26-44-38(4,5)46-34/h6-11,15-16,18-19,27,30-32,34H,12-14,17,20-26H2,1-5H3,(H,39,43)(H,40,42)/t27?,30?,31?,32-,34?/m0/s1 |
| InChIKey | WLWZMAMZFOTQGU-PQDMTZACSA-N |
| XLogP | 6.47 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.86 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |