C20H24N2O4 — CID 22844518
1-[[(1R,2R)-2-[3-(4-ethylphenoxy)phenyl]cyclopropyl]methyl]-1,3-dihydroxy-3-methylurea (PubChem CID 22844518) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 1-[[(1R,2R)-2-[3-(4-ethylphenoxy)phenyl]cyclopropyl]methyl]-1,3-dihydroxy-3-methylurea.
| Compound Name | 1-[[(1R,2R)-2-[3-(4-ethylphenoxy)phenyl]cyclopropyl]methyl]-1,3-dihydroxy-3-methylurea |
|---|---|
| PubChem CID | 22844518 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-[[(1R,2R)-2-[3-(4-ethylphenoxy)phenyl]cyclopropyl]methyl]-1,3-dihydroxy-3-methylurea |
| SMILES | CCc1ccc(Oc2cccc([C@@H]3C[C@H]3CN(O)C(=O)N(C)O)c2)cc1 |
| InChI | InChI=1S/C20H24N2O4/c1-3-14-7-9-17(10-8-14)26-18-6-4-5-15(11-18)19-12-16(19)13-22(25)20(23)21(2)24/h4-11,16,19,24-25H,3,12-13H2,1-2H3/t16-,19-/m0/s1 |
| InChIKey | DTKYAEQSCLNXID-LPHOPBHVSA-N |
| XLogP | 4.28 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|