About (3R,4S)-4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol
(3R,4S)-4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol (PubChem CID 22844600) has the molecular formula C15H30N2O3
and a molecular weight of 286.42 g/mol. Its IUPAC name is (3R,4S)-4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol.
Molecular Properties
| Compound Name | (3R,4S)-4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol |
| PubChem CID | 22844600 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (3R,4S)-4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol |
| SMILES | N[C@@H](CC1CCCCC1)[C@@H](O)C(O)CN1CCOCC1 |
| InChI | InChI=1S/C15H30N2O3/c16-13(10-12-4-2-1-3-5-12)15(19)14(18)11-17-6-8-20-9-7-17/h12-15,18-19H,1-11,16H2/t13-,14?,15+/m0/s1 |
| InChIKey | NHDDZVQPIPEHDA-ZHDDOTHNSA-N |
| XLogP | 0.34 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R,4S)-4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol?
The IUPAC name of (3R,4S)-4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol (CID 22844600) is (3R,4S)-4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol.
What is the SMILES notation for (3R,4S)-4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol?
The canonical SMILES for (3R,4S)-4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol is N[C@@H](CC1CCCCC1)[C@@H](O)C(O)CN1CCOCC1.
What is the InChIKey of (3R,4S)-4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol?
The InChIKey is NHDDZVQPIPEHDA-ZHDDOTHNSA-N. The full InChI is InChI=1S/C15H30N2O3/c16-13(10-12-4-2-1-3-5-12)15(19)14(18)11-17-6-8-20-9-7-17/h12-15,18-19H,1-11,16H2/t13-,14?,15+/m0/s1.
What are the key properties of (3R,4S)-4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol?
(3R,4S)-4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol has a molecular weight of 286.42 g/mol, XLogP of 0.34, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol is sourced from PubChem (CID 22844600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).