C15H25NO5 — CID 22845141
(3S)-3-acetamido-4-oxo-4-(3,3,5-trimethylcyclohexyl)oxybutanoic acid (PubChem CID 22845141) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is (3S)-3-acetamido-4-oxo-4-(3,3,5-trimethylcyclohexyl)oxybutanoic acid.
| Compound Name | (3S)-3-acetamido-4-oxo-4-(3,3,5-trimethylcyclohexyl)oxybutanoic acid |
|---|---|
| PubChem CID | 22845141 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (3S)-3-acetamido-4-oxo-4-(3,3,5-trimethylcyclohexyl)oxybutanoic acid |
| SMILES | CC(=O)N[C@@H](CC(=O)O)C(=O)OC1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C15H25NO5/c1-9-5-11(8-15(3,4)7-9)21-14(20)12(6-13(18)19)16-10(2)17/h9,11-12H,5-8H2,1-4H3,(H,16,17)(H,18,19)/t9?,11?,12-/m0/s1 |
| InChIKey | RDJALIOERZKOPK-NHNAUAITSA-N |
| XLogP | 1.72 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |