C23H41N3O7 — CID 22845153
(2S,8S)-2-amino-10-[[2-[[(2R)-1-butoxy-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-6,8-diethyl-5,10-dioxodecanoic acid (PubChem CID 22845153) has the molecular formula C23H41N3O7 and a molecular weight of 471.60 g/mol. Its IUPAC name is (2S,8S)-2-amino-10-[[2-[[(2R)-1-butoxy-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-6,8-diethyl-5,10-dioxodecanoic acid.
| Compound Name | (2S,8S)-2-amino-10-[[2-[[(2R)-1-butoxy-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-6,8-diethyl-5,10-dioxodecanoic acid |
|---|---|
| PubChem CID | 22845153 |
| Molecular Formula | C23H41N3O7 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | (2S,8S)-2-amino-10-[[2-[[(2R)-1-butoxy-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-6,8-diethyl-5,10-dioxodecanoic acid |
| SMILES | CCCCOC(=O)[C@@H](C)NC(=O)CNC(=O)C[C@@H](CC)CC(CC)C(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C23H41N3O7/c1-5-8-11-33-23(32)15(4)26-21(29)14-25-20(28)13-16(6-2)12-17(7-3)19(27)10-9-18(24)22(30)31/h15-18H,5-14,24H2,1-4H3,(H,25,28)(H,26,29)(H,30,31)/t15-,16+,17?,18+/m1/s1 |
| InChIKey | LACJYMMCRKVERK-BHGSFYIQSA-N |
| XLogP | 1.54 |
| TPSA | 164.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|