C20H18FN5O2 — CID 22845493
1-cyano-1-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2-(4-fluorophenyl)guanidine (PubChem CID 22845493) has the molecular formula C20H18FN5O2 and a molecular weight of 379.40 g/mol. Its IUPAC name is 1-cyano-1-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2-(4-fluorophenyl)guanidine.
| Compound Name | 1-cyano-1-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2-(4-fluorophenyl)guanidine |
|---|---|
| PubChem CID | 22845493 |
| Molecular Formula | C20H18FN5O2 |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 1-cyano-1-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2-(4-fluorophenyl)guanidine |
| SMILES | CC1(C)Oc2ccc(C#N)cc2[C@H](N(C#N)/C(N)=N/c2ccc(F)cc2)[C@H]1O |
| InChI | InChI=1S/C20H18FN5O2/c1-20(2)18(27)17(15-9-12(10-22)3-8-16(15)28-20)26(11-23)19(24)25-14-6-4-13(21)5-7-14/h3-9,17-18,27H,1-2H3,(H2,24,25)/t17-,18+/m0/s1 |
| InChIKey | VYGSTTAVXNRVON-ZWKOTPCHSA-N |
| XLogP | 2.70 |
| TPSA | 118.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|