About (E)-4-(1,3-dithian-2-yl)-2-fluorobut-2-en-1-ol
(E)-4-(1,3-dithian-2-yl)-2-fluorobut-2-en-1-ol (PubChem CID 22845811) has the molecular formula C8H13FOS2
and a molecular weight of 208.32 g/mol. Its IUPAC name is (E)-4-(1,3-dithian-2-yl)-2-fluorobut-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-4-(1,3-dithian-2-yl)-2-fluorobut-2-en-1-ol |
| PubChem CID | 22845811 |
| Molecular Formula | C8H13FOS2 |
| Molecular Weight | 208.32 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | (E)-4-(1,3-dithian-2-yl)-2-fluorobut-2-en-1-ol |
| SMILES | OC/C(F)=C\CC1SCCCS1 |
| InChI | InChI=1S/C8H13FOS2/c9-7(6-10)2-3-8-11-4-1-5-12-8/h2,8,10H,1,3-6H2/b7-2+ |
| InChIKey | UNSVSWDPKZHLKB-FARCUNLSSA-N |
| XLogP | 2.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E)-4-(1,3-dithian-2-yl)-2-fluorobut-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(1,3-dithian-2-yl)-2-fluorobut-2-en-1-ol?
The IUPAC name of (E)-4-(1,3-dithian-2-yl)-2-fluorobut-2-en-1-ol (CID 22845811) is (E)-4-(1,3-dithian-2-yl)-2-fluorobut-2-en-1-ol.
What is the SMILES notation for (E)-4-(1,3-dithian-2-yl)-2-fluorobut-2-en-1-ol?
The canonical SMILES for (E)-4-(1,3-dithian-2-yl)-2-fluorobut-2-en-1-ol is OC/C(F)=C\CC1SCCCS1.
What is the InChIKey of (E)-4-(1,3-dithian-2-yl)-2-fluorobut-2-en-1-ol?
The InChIKey is UNSVSWDPKZHLKB-FARCUNLSSA-N. The full InChI is InChI=1S/C8H13FOS2/c9-7(6-10)2-3-8-11-4-1-5-12-8/h2,8,10H,1,3-6H2/b7-2+.
What are the key properties of (E)-4-(1,3-dithian-2-yl)-2-fluorobut-2-en-1-ol?
(E)-4-(1,3-dithian-2-yl)-2-fluorobut-2-en-1-ol has a molecular weight of 208.32 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(1,3-dithian-2-yl)-2-fluorobut-2-en-1-ol is sourced from PubChem (CID 22845811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).