C25H36O8 — CID 22845958
[(E,6Z)-2,3-diacetyloxy-6-(2-hydroxy-2-octyl-5-oxocyclopent-3-en-1-ylidene)hex-4-enyl] acetate (PubChem CID 22845958) has the molecular formula C25H36O8 and a molecular weight of 464.56 g/mol. Its IUPAC name is [(E,6Z)-2,3-diacetyloxy-6-(2-hydroxy-2-octyl-5-oxocyclopent-3-en-1-ylidene)hex-4-enyl] acetate.
| Compound Name | [(E,6Z)-2,3-diacetyloxy-6-(2-hydroxy-2-octyl-5-oxocyclopent-3-en-1-ylidene)hex-4-enyl] acetate |
|---|---|
| PubChem CID | 22845958 |
| Molecular Formula | C25H36O8 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | [(E,6Z)-2,3-diacetyloxy-6-(2-hydroxy-2-octyl-5-oxocyclopent-3-en-1-ylidene)hex-4-enyl] acetate |
| SMILES | CCCCCCCCC1(O)C=CC(=O)/C1=C\C=C\C(OC(C)=O)C(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C25H36O8/c1-5-6-7-8-9-10-15-25(30)16-14-22(29)21(25)12-11-13-23(32-19(3)27)24(33-20(4)28)17-31-18(2)26/h11-14,16,23-24,30H,5-10,15,17H2,1-4H3/b13-11+,21-12+ |
| InChIKey | FPBCLRZDRLEQQH-QLCGXXCYSA-N |
| XLogP | 3.52 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|