C8H9F3O2 — CID 22845979
(E)-3-[(2R,3R)-3-(3,3,3-trifluoropropyl)oxiran-2-yl]prop-2-enal (PubChem CID 22845979) has the molecular formula C8H9F3O2 and a molecular weight of 194.15 g/mol. Its IUPAC name is (E)-3-[(2R,3R)-3-(3,3,3-trifluoropropyl)oxiran-2-yl]prop-2-enal.
| Compound Name | (E)-3-[(2R,3R)-3-(3,3,3-trifluoropropyl)oxiran-2-yl]prop-2-enal |
|---|---|
| PubChem CID | 22845979 |
| Molecular Formula | C8H9F3O2 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (E)-3-[(2R,3R)-3-(3,3,3-trifluoropropyl)oxiran-2-yl]prop-2-enal |
| SMILES | O=C/C=C/[C@H]1O[C@@H]1CCC(F)(F)F |
| InChI | InChI=1S/C8H9F3O2/c9-8(10,11)4-3-7-6(13-7)2-1-5-12/h1-2,5-7H,3-4H2/b2-1+/t6-,7-/m1/s1 |
| InChIKey | HRTFEROMHXEGME-LJSRPMLZSA-N |
| XLogP | 1.85 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|