C21H28O6 — CID 22846005
[7-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-2,2,4,6-tetramethyl-3H-1-benzofuran-5-yl] acetate (PubChem CID 22846005) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is [7-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-2,2,4,6-tetramethyl-3H-1-benzofuran-5-yl] acetate.
| Compound Name | [7-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-2,2,4,6-tetramethyl-3H-1-benzofuran-5-yl] acetate |
|---|---|
| PubChem CID | 22846005 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | [7-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-2,2,4,6-tetramethyl-3H-1-benzofuran-5-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c(CC[C@@H]2C[C@@H](O)CC(=O)O2)c2c(c1C)CC(C)(C)O2 |
| InChI | InChI=1S/C21H28O6/c1-11-16(7-6-15-8-14(23)9-18(24)26-15)20-17(10-21(4,5)27-20)12(2)19(11)25-13(3)22/h14-15,23H,6-10H2,1-5H3/t14-,15-/m1/s1 |
| InChIKey | QIZJXKKXCWKOJR-HUUCEWRRSA-N |
| XLogP | 2.94 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|