C25H22N2O4 — CID 22846378
(2S,3S)-2-hydroxy-3-phenyl-3-[4-(quinolin-2-ylmethoxy)anilino]propanoic acid (PubChem CID 22846378) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is (2S,3S)-2-hydroxy-3-phenyl-3-[4-(quinolin-2-ylmethoxy)anilino]propanoic acid.
| Compound Name | (2S,3S)-2-hydroxy-3-phenyl-3-[4-(quinolin-2-ylmethoxy)anilino]propanoic acid |
|---|---|
| PubChem CID | 22846378 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | (2S,3S)-2-hydroxy-3-phenyl-3-[4-(quinolin-2-ylmethoxy)anilino]propanoic acid |
| SMILES | O=C(O)[C@@H](O)[C@@H](Nc1ccc(OCc2ccc3ccccc3n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H22N2O4/c28-24(25(29)30)23(18-7-2-1-3-8-18)27-19-12-14-21(15-13-19)31-16-20-11-10-17-6-4-5-9-22(17)26-20/h1-15,23-24,27-28H,16H2,(H,29,30)/t23-,24-/m0/s1 |
| InChIKey | KJZAPJYQOFCSSC-ZEQRLZLVSA-N |
| XLogP | 4.41 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|