About methyl (2S)-2-[[(2R,3S)-2-amino-3-methylpentyl]amino]-4-methylsulfanylbutanoate
methyl (2S)-2-[[(2R,3S)-2-amino-3-methylpentyl]amino]-4-methylsulfanylbutanoate (PubChem CID 22846552) has the molecular formula C12H26N2O2S
and a molecular weight of 262.42 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R,3S)-2-amino-3-methylpentyl]amino]-4-methylsulfanylbutanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[[(2R,3S)-2-amino-3-methylpentyl]amino]-4-methylsulfanylbutanoate |
| PubChem CID | 22846552 |
| Molecular Formula | C12H26N2O2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | methyl (2S)-2-[[(2R,3S)-2-amino-3-methylpentyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CC[C@H](C)[C@@H](N)CN[C@@H](CCSC)C(=O)OC |
| InChI | InChI=1S/C12H26N2O2S/c1-5-9(2)10(13)8-14-11(6-7-17-4)12(15)16-3/h9-11,14H,5-8,13H2,1-4H3/t9-,10-,11-/m0/s1 |
| InChIKey | BGMZOJQAHFZUKV-DCAQKATOSA-N |
| XLogP | 1.24 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2S)-2-[[(2R,3S)-2-amino-3-methylpentyl]amino]-4-methylsulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[[(2R,3S)-2-amino-3-methylpentyl]amino]-4-methylsulfanylbutanoate?
The IUPAC name of methyl (2S)-2-[[(2R,3S)-2-amino-3-methylpentyl]amino]-4-methylsulfanylbutanoate (CID 22846552) is methyl (2S)-2-[[(2R,3S)-2-amino-3-methylpentyl]amino]-4-methylsulfanylbutanoate.
What is the SMILES notation for methyl (2S)-2-[[(2R,3S)-2-amino-3-methylpentyl]amino]-4-methylsulfanylbutanoate?
The canonical SMILES for methyl (2S)-2-[[(2R,3S)-2-amino-3-methylpentyl]amino]-4-methylsulfanylbutanoate is CC[C@H](C)[C@@H](N)CN[C@@H](CCSC)C(=O)OC.
What is the InChIKey of methyl (2S)-2-[[(2R,3S)-2-amino-3-methylpentyl]amino]-4-methylsulfanylbutanoate?
The InChIKey is BGMZOJQAHFZUKV-DCAQKATOSA-N. The full InChI is InChI=1S/C12H26N2O2S/c1-5-9(2)10(13)8-14-11(6-7-17-4)12(15)16-3/h9-11,14H,5-8,13H2,1-4H3/t9-,10-,11-/m0/s1.
What are the key properties of methyl (2S)-2-[[(2R,3S)-2-amino-3-methylpentyl]amino]-4-methylsulfanylbutanoate?
methyl (2S)-2-[[(2R,3S)-2-amino-3-methylpentyl]amino]-4-methylsulfanylbutanoate has a molecular weight of 262.42 g/mol, XLogP of 1.24, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[[(2R,3S)-2-amino-3-methylpentyl]amino]-4-methylsulfanylbutanoate is sourced from PubChem (CID 22846552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).