C6H10O6S — CID 22846649
(2S,3S,4S,5R)-3,4,5-trihydroxy-6-sulfanyloxane-2-carboxylic acid (PubChem CID 22846649) has the molecular formula C6H10O6S and a molecular weight of 210.21 g/mol. Its IUPAC name is (2S,3S,4S,5R)-3,4,5-trihydroxy-6-sulfanyloxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-6-sulfanyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 22846649 |
| Molecular Formula | C6H10O6S |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-6-sulfanyloxane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1OC(S)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H10O6S/c7-1-2(8)4(5(10)11)12-6(13)3(1)9/h1-4,6-9,13H,(H,10,11)/t1-,2-,3+,4-,6?/m0/s1 |
| InChIKey | JSWJULLTYQYYMZ-AQKNRBDQSA-N |
| XLogP | -2.19 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|