C12H18F2N4O2 — CID 22847402
(4S,5R)-5-(2-azido-1,1-difluoroethyl)-4-(cyclohexylmethyl)-1,3-oxazolidin-2-one (PubChem CID 22847402) has the molecular formula C12H18F2N4O2 and a molecular weight of 288.30 g/mol. Its IUPAC name is (4S,5R)-5-(2-azido-1,1-difluoroethyl)-4-(cyclohexylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-5-(2-azido-1,1-difluoroethyl)-4-(cyclohexylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 22847402 |
| Molecular Formula | C12H18F2N4O2 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (4S,5R)-5-(2-azido-1,1-difluoroethyl)-4-(cyclohexylmethyl)-1,3-oxazolidin-2-one |
| SMILES | [N-]=[N+]=NCC(F)(F)[C@@H]1OC(=O)N[C@H]1CC1CCCCC1 |
| InChI | InChI=1S/C12H18F2N4O2/c13-12(14,7-16-18-15)10-9(17-11(19)20-10)6-8-4-2-1-3-5-8/h8-10H,1-7H2,(H,17,19)/t9-,10+/m0/s1 |
| InChIKey | CJUPJRUWFIBKMN-VHSXEESVSA-N |
| XLogP | 3.38 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|