C9H12N2O4 — CID 22847476
(3S,4R,5R)-2-pyrimidin-2-yloxane-3,4,5-triol (PubChem CID 22847476) has the molecular formula C9H12N2O4 and a molecular weight of 212.21 g/mol. Its IUPAC name is (3S,4R,5R)-2-pyrimidin-2-yloxane-3,4,5-triol.
| Compound Name | (3S,4R,5R)-2-pyrimidin-2-yloxane-3,4,5-triol |
|---|---|
| PubChem CID | 22847476 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (3S,4R,5R)-2-pyrimidin-2-yloxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@H](O)COC(c2ncccn2)[C@H]1O |
| InChI | InChI=1S/C9H12N2O4/c12-5-4-15-8(7(14)6(5)13)9-10-2-1-3-11-9/h1-3,5-8,12-14H,4H2/t5-,6-,7+,8?/m1/s1 |
| InChIKey | ZYRPYARSBLLQPT-HBFKVTOISA-N |
| XLogP | -1.37 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |