C37H56N4O4 — CID 22847820
(2S,4S)-N-[(2S,3S,5S)-1-cyclohexyl-3-hydroxy-5-propan-2-ylhept-6-en-2-yl]-4-(3,3-dimethylbutanoylamino)-2-(1H-imidazol-5-ylmethyl)-3-oxo-5-phenylpentanamide (PubChem CID 22847820) has the molecular formula C37H56N4O4 and a molecular weight of 620.88 g/mol. Its IUPAC name is (2S,4S)-N-[(2S,3S,5S)-1-cyclohexyl-3-hydroxy-5-propan-2-ylhept-6-en-2-yl]-4-(3,3-dimethylbutanoylamino)-2-(1H-imidazol-5-ylmethyl)-3-oxo-5-phenylpentanamide.
| Compound Name | (2S,4S)-N-[(2S,3S,5S)-1-cyclohexyl-3-hydroxy-5-propan-2-ylhept-6-en-2-yl]-4-(3,3-dimethylbutanoylamino)-2-(1H-imidazol-5-ylmethyl)-3-oxo-5-phenylpentanamide |
|---|---|
| PubChem CID | 22847820 |
| Molecular Formula | C37H56N4O4 |
| Molecular Weight | 620.88 g/mol |
| Exact Mass | 620.43 |
| IUPAC Name | (2S,4S)-N-[(2S,3S,5S)-1-cyclohexyl-3-hydroxy-5-propan-2-ylhept-6-en-2-yl]-4-(3,3-dimethylbutanoylamino)-2-(1H-imidazol-5-ylmethyl)-3-oxo-5-phenylpentanamide |
| SMILES | C=CC(C[C@H](O)[C@H](CC1CCCCC1)NC(=O)[C@@H](Cc1cnc[nH]1)C(=O)[C@H](Cc1ccccc1)NC(=O)CC(C)(C)C)C(C)C |
| InChI | InChI=1S/C37H56N4O4/c1-7-28(25(2)3)20-33(42)31(18-26-14-10-8-11-15-26)41-36(45)30(21-29-23-38-24-39-29)35(44)32(19-27-16-12-9-13-17-27)40-34(43)22-37(4,5)6/h7,9,12-13,16-17,23-26,28,30-33,42H,1,8,10-11,14-15,18-22H2,2-6H3,(H,38,39)(H,40,43)(H,41,45)/t28?,30-,31-,32-,33-/m0/s1 |
| InChIKey | TWJIVQGWBDMDRI-DLEDVHIPSA-N |
| XLogP | 5.97 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.88 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|