C24H38ClNO6 — CID 22848040
[(3R,4aR,5S,10S,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,8,9,10-tetrahydro-2H-benzo[f]chromen-5-yl] 2-(dimethylamino)acetate;hydrochloride (PubChem CID 22848040) has the molecular formula C24H38ClNO6 and a molecular weight of 472.02 g/mol. Its IUPAC name is [(3R,4aR,5S,10S,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,8,9,10-tetrahydro-2H-benzo[f]chromen-5-yl] 2-(dimethylamino)acetate;hydrochloride.
| Compound Name | [(3R,4aR,5S,10S,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,8,9,10-tetrahydro-2H-benzo[f]chromen-5-yl] 2-(dimethylamino)acetate;hydrochloride |
|---|---|
| PubChem CID | 22848040 |
| Molecular Formula | C24H38ClNO6 |
| Molecular Weight | 472.02 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | [(3R,4aR,5S,10S,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,8,9,10-tetrahydro-2H-benzo[f]chromen-5-yl] 2-(dimethylamino)acetate;hydrochloride |
| SMILES | C=C[C@@]1(C)CC(=O)[C@@]2(O)[C@](C)(O1)[C@@H](OC(=O)CN(C)C)C=C1C(C)(C)CC[C@H](O)[C@@]12C.Cl |
| InChI | InChI=1S/C24H37NO6.ClH/c1-9-21(4)13-17(27)24(29)22(5)15(20(2,3)11-10-16(22)26)12-18(23(24,6)31-21)30-19(28)14-25(7)8;/h9,12,16,18,26,29H,1,10-11,13-14H2,2-8H3;1H/t16-,18-,21-,22+,23+,24-;/m0./s1 |
| InChIKey | NMTNKVAUBLTXTJ-VOGYNJPOSA-N |
| XLogP | 2.43 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.02 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|