C27H42O2 — CID 22848181
(3R,5S)-3-hexyl-5-[4-(4-pentylcyclohexyl)phenyl]oxolan-2-one (PubChem CID 22848181) has the molecular formula C27H42O2 and a molecular weight of 398.63 g/mol. Its IUPAC name is (3R,5S)-3-hexyl-5-[4-(4-pentylcyclohexyl)phenyl]oxolan-2-one.
| Compound Name | (3R,5S)-3-hexyl-5-[4-(4-pentylcyclohexyl)phenyl]oxolan-2-one |
|---|---|
| PubChem CID | 22848181 |
| Molecular Formula | C27H42O2 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | (3R,5S)-3-hexyl-5-[4-(4-pentylcyclohexyl)phenyl]oxolan-2-one |
| SMILES | CCCCCC[C@@H]1C[C@@H](c2ccc(C3CCC(CCCCC)CC3)cc2)OC1=O |
| InChI | InChI=1S/C27H42O2/c1-3-5-7-9-11-25-20-26(29-27(25)28)24-18-16-23(17-19-24)22-14-12-21(13-15-22)10-8-6-4-2/h16-19,21-22,25-26H,3-15,20H2,1-2H3/t21?,22?,25-,26+/m1/s1 |
| InChIKey | MHSBKFMBKZEIBQ-FJJJVWAOSA-N |
| XLogP | 8.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|