C10H18N2O4S — CID 22848427
2-[(4R,6S)-6-[(carbamothioylamino)methyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid (PubChem CID 22848427) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is 2-[(4R,6S)-6-[(carbamothioylamino)methyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid.
| Compound Name | 2-[(4R,6S)-6-[(carbamothioylamino)methyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 22848427 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-[(4R,6S)-6-[(carbamothioylamino)methyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid |
| SMILES | CC1(C)O[C@H](CNC(N)=S)C[C@H](CC(=O)O)O1 |
| InChI | InChI=1S/C10H18N2O4S/c1-10(2)15-6(4-8(13)14)3-7(16-10)5-12-9(11)17/h6-7H,3-5H2,1-2H3,(H,13,14)(H3,11,12,17)/t6-,7+/m1/s1 |
| InChIKey | IBOLQCLDXINAIF-RQJHMYQMSA-N |
| XLogP | 0.20 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|